C22H21N3O3 — CID 55355003
2-[[2-(3-methoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide (PubChem CID 55355003) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[[2-(3-methoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-(3-methoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 55355003 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[[2-(3-methoxyanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
| SMILES | COc1cccc(NC(=O)CNc2ccccc2C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-28-18-11-7-10-17(14-18)24-21(26)15-23-20-13-6-5-12-19(20)22(27)25-16-8-3-2-4-9-16/h2-14,23H,15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | OLKFEEXAXQOGFG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |