C22H20ClN3O3 — CID 9084498
N-(4-chlorophenyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide (PubChem CID 9084498) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 9084498 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[2-(4-methoxyanilino)-2-oxoethyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)CNc2ccccc2C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-29-18-12-10-16(11-13-18)25-21(27)14-24-20-5-3-2-4-19(20)22(28)26-17-8-6-15(23)7-9-17/h2-13,24H,14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | RXQZRQAMRGFRIP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |