C24H26N4O3 — CID 9105472
2-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-N-(4-methoxyphenyl)benzamide (PubChem CID 9105472) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 2-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 9105472 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-[[2-[4-(dimethylamino)anilino]-2-oxoethyl]amino]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2NCC(=O)Nc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-28(2)19-12-8-17(9-13-19)26-23(29)16-25-22-7-5-4-6-21(22)24(30)27-18-10-14-20(31-3)15-11-18/h4-15,25H,16H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | RFZMHVKVHUXFGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|