C22H20ClN3O2 — CID 18205586
N-(4-chlorophenyl)-2-[[2-(4-methylanilino)-2-oxoethyl]amino]benzamide (PubChem CID 18205586) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[[2-(4-methylanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | N-(4-chlorophenyl)-2-[[2-(4-methylanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 18205586 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[[2-(4-methylanilino)-2-oxoethyl]amino]benzamide |
| SMILES | Cc1ccc(NC(=O)CNc2ccccc2C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O2/c1-15-6-10-17(11-7-15)25-21(27)14-24-20-5-3-2-4-19(20)22(28)26-18-12-8-16(23)9-13-18/h2-13,24H,14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | FQSVQXKWMMUBNN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |