C23H22ClN3O2 — CID 9106367
2-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]amino]-N-(4-methylphenyl)benzamide (PubChem CID 9106367) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]amino]-N-(4-methylphenyl)benzamide.
| Compound Name | 2-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]amino]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 9106367 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]amino]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NCC(=O)Nc2ccc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C23H22ClN3O2/c1-15-7-10-17(11-8-15)26-23(29)18-5-3-4-6-20(18)25-14-22(28)27-21-12-9-16(2)13-19(21)24/h3-13,25H,14H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | IUCGSFOZMVOKCJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |