C23H23N3O2 — CID 9105938
2-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]-N-phenylbenzamide (PubChem CID 9105938) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 9105938 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[[2-(2,4-dimethylanilino)-2-oxoethyl]amino]-N-phenylbenzamide |
| SMILES | Cc1ccc(NC(=O)CNc2ccccc2C(=O)Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H23N3O2/c1-16-12-13-20(17(2)14-16)26-22(27)15-24-21-11-7-6-10-19(21)23(28)25-18-8-4-3-5-9-18/h3-14,24H,15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | FHVHZRSYYCDSAF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |