C27H23N3O2 — CID 9106026
2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]-N-phenylbenzamide (PubChem CID 9106026) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 9106026 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[[2-oxo-2-(2-phenylanilino)ethyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CNc1ccccc1C(=O)Nc1ccccc1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C27H23N3O2/c31-26(30-25-18-10-7-15-22(25)20-11-3-1-4-12-20)19-28-24-17-9-8-16-23(24)27(32)29-21-13-5-2-6-14-21/h1-18,28H,19H2,(H,29,32)(H,30,31) |
| InChIKey | PFQUOFWKDVPVGN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |