C24H23ClN4O3 — CID 16555132
2-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide (PubChem CID 16555132) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 2-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 16555132 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[[2-[[2-(4-chloroanilino)-2-oxoethyl]-methylamino]acetyl]amino]-N-phenylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cc1)CC(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H23ClN4O3/c1-29(15-22(30)26-19-13-11-17(25)12-14-19)16-23(31)28-21-10-6-5-9-20(21)24(32)27-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H,26,30)(H,27,32)(H,28,31) |
| InChIKey | AGINQPURFWWBFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |