C17H18FN3O2 — CID 2608827
2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-phenylacetamide (PubChem CID 2608827) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-phenylacetamide.
| Compound Name | 2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-phenylacetamide |
|---|---|
| PubChem CID | 2608827 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[[2-(4-fluoroanilino)-2-oxoethyl]-methylamino]-N-phenylacetamide |
| SMILES | CN(CC(=O)Nc1ccccc1)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O2/c1-21(11-16(22)19-14-5-3-2-4-6-14)12-17(23)20-15-9-7-13(18)8-10-15/h2-10H,11-12H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | IMHFLTWWTZELJO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |