C19H22FN3O2 — CID 9253364
N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]amino]acetamide (PubChem CID 9253364) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9253364 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]amino]acetamide |
| SMILES | C[C@H](NC(=O)CN(C)CC(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-14(15-6-4-3-5-7-15)21-18(24)12-23(2)13-19(25)22-17-10-8-16(20)9-11-17/h3-11,14H,12-13H2,1-2H3,(H,21,24)(H,22,25)/t14-/m0/s1 |
| InChIKey | JJGZXXCXHXLBLM-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |