C16H24FN3O2 — CID 9253582
N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl]amino]acetamide (PubChem CID 9253582) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9253582 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-[methyl-[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl]amino]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)CN(C)CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FN3O2/c1-4-5-12(2)18-15(21)10-20(3)11-16(22)19-14-8-6-13(17)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H,18,21)(H,19,22)/t12-/m1/s1 |
| InChIKey | WRQZOLCLNCUQLI-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |