C23H22FN3O2 — CID 2474016
2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-phenylbenzamide (PubChem CID 2474016) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 2474016 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[[2-[(2-fluorophenyl)methyl-methylamino]acetyl]amino]-N-phenylbenzamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(=O)Nc1ccccc1)Cc1ccccc1F |
| InChI | InChI=1S/C23H22FN3O2/c1-27(15-17-9-5-7-13-20(17)24)16-22(28)26-21-14-8-6-12-19(21)23(29)25-18-10-3-2-4-11-18/h2-14H,15-16H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | COVQNLYZYBDSOM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |