C25H25N3O3 — CID 8729554
2-[[2-(2-benzoylanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide (PubChem CID 8729554) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[2-(2-benzoylanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[2-(2-benzoylanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8729554 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[[2-(2-benzoylanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)CC(=O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-18-12-14-20(15-13-18)26-23(29)16-28(2)17-24(30)27-22-11-7-6-10-21(22)25(31)19-8-4-3-5-9-19/h3-15H,16-17H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | OYVWQQYZSHSHLG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |