C18H20N2O3 — CID 110880676
N-(2-benzoylphenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide (PubChem CID 110880676) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide.
| Compound Name | N-(2-benzoylphenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 110880676 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(2-benzoylphenyl)-2-[2-hydroxyethyl(methyl)amino]acetamide |
| SMILES | CN(CCO)CC(=O)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-20(11-12-21)13-17(22)19-16-10-6-5-9-15(16)18(23)14-7-3-2-4-8-14/h2-10,21H,11-13H2,1H3,(H,19,22) |
| InChIKey | LJHSCSKHAHRBTI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |