C20H24N4O3 — CID 17431317
2-[[2-(3-acetamidoanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide (PubChem CID 17431317) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17431317 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[[2-(3-acetamidoanilino)-2-oxoethyl]-methylamino]-N-(4-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CN(C)CC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-14-7-9-16(10-8-14)22-19(26)12-24(3)13-20(27)23-18-6-4-5-17(11-18)21-15(2)25/h4-11H,12-13H2,1-3H3,(H,21,25)(H,22,26)(H,23,27) |
| InChIKey | GZDLYSJJFAORTI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |