C18H21N3O4S — CID 27055361
N-(3-acetamidophenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 27055361) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 27055361 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CN(C)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H21N3O4S/c1-13-7-9-17(10-8-13)26(24,25)21(3)12-18(23)20-16-6-4-5-15(11-16)19-14(2)22/h4-11H,12H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | RNXREBDLWZLJHX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |