C22H21ClN4O4S — CID 46508678
2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[3-(phenylcarbamoylamino)phenyl]acetamide (PubChem CID 46508678) has the molecular formula C22H21ClN4O4S and a molecular weight of 472.95 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[3-(phenylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[3-(phenylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 46508678 |
| Molecular Formula | C22H21ClN4O4S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-methylamino]-N-[3-(phenylcarbamoylamino)phenyl]acetamide |
| SMILES | CN(CC(=O)Nc1cccc(NC(=O)Nc2ccccc2)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN4O4S/c1-27(32(30,31)20-12-10-16(23)11-13-20)15-21(28)24-18-8-5-9-19(14-18)26-22(29)25-17-6-3-2-4-7-17/h2-14H,15H2,1H3,(H,24,28)(H2,25,26,29) |
| InChIKey | DWFLOCJVZFDEFJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |