C17H23N5O3 — CID 51087127
N-(3-acetamidophenyl)-2-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-methylamino]acetamide (PubChem CID 51087127) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 51087127 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl]-methylamino]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CN(C)CC(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C17H23N5O3/c1-13(23)19-14-6-4-7-15(10-14)20-16(24)11-21(2)12-17(25)22(3)9-5-8-18/h4,6-7,10H,5,9,11-12H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | SKWDXYVMBPTURV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |