C18H20ClN3O2S — CID 4806218
N-(4-chlorophenyl)-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide (PubChem CID 4806218) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 4806218 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]amino]acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O2S/c1-22(11-17(23)20-14-9-7-13(19)8-10-14)12-18(24)21-15-5-3-4-6-16(15)25-2/h3-10H,11-12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | VXMUIWSFNGAZHD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |