C17H26N4O4 — CID 8594468
(2S)-N-ethyl-2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]propanamide (PubChem CID 8594468) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2S)-N-ethyl-2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]propanamide.
| Compound Name | (2S)-N-ethyl-2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 8594468 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2S)-N-ethyl-2-[[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]acetyl]amino]propanamide |
| SMILES | CCNC(=O)[C@H](C)NC(=O)CN(C)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C17H26N4O4/c1-5-18-17(24)12(2)19-15(22)10-21(3)11-16(23)20-13-7-6-8-14(9-13)25-4/h6-9,12H,5,10-11H2,1-4H3,(H,18,24)(H,19,22)(H,20,23)/t12-/m0/s1 |
| InChIKey | HIMXCPPSBYAOEP-LBPRGKRZSA-N |
| XLogP | 0.21 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |