C27H47N3O2 — CID 4564479
2-N,6-N-didecylpyridine-2,6-dicarboxamide (PubChem CID 4564479) has the molecular formula C27H47N3O2 and a molecular weight of 445.69 g/mol. Its IUPAC name is 2-N,6-N-didecylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-didecylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4564479 |
| Molecular Formula | C27H47N3O2 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.37 |
| IUPAC Name | 2-N,6-N-didecylpyridine-2,6-dicarboxamide |
| SMILES | CCCCCCCCCCNC(=O)c1cccc(C(=O)NCCCCCCCCCC)n1 |
| InChI | InChI=1S/C27H47N3O2/c1-3-5-7-9-11-13-15-17-22-28-26(31)24-20-19-21-25(30-24)27(32)29-23-18-16-14-12-10-8-6-4-2/h19-21H,3-18,22-23H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | LPVJHIGFAVHZKI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|