C54H84N12O6 — CID 14294049
4-N,5-N,10-N,11-N,16-N,17-N-hexahexyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-4,5,10,11,16,17-hexacarboxamide (PubChem CID 14294049) has the molecular formula C54H84N12O6 and a molecular weight of 997.34 g/mol. Its IUPAC name is 4-N,5-N,10-N,11-N,16-N,17-N-hexahexyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-4,5,10,11,16,17-hexacarboxamide.
| Compound Name | 4-N,5-N,10-N,11-N,16-N,17-N-hexahexyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-4,5,10,11,16,17-hexacarboxamide |
|---|---|
| PubChem CID | 14294049 |
| Molecular Formula | C54H84N12O6 |
| Molecular Weight | 997.34 g/mol |
| Exact Mass | 996.66 |
| IUPAC Name | 4-N,5-N,10-N,11-N,16-N,17-N-hexahexyl-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene-4,5,10,11,16,17-hexacarboxamide |
| SMILES | CCCCCCNC(=O)c1nc2c3nc(C(=O)NCCCCCC)c(C(=O)NCCCCCC)nc3c3nc(C(=O)NCCCCCC)c(C(=O)NCCCCCC)nc3c2nc1C(=O)NCCCCCC |
| InChI | InChI=1S/C54H84N12O6/c1-7-13-19-25-31-55-49(67)43-44(50(68)56-32-26-20-14-8-2)62-38-37(61-43)39-41(65-46(52(70)58-34-28-22-16-10-4)45(63-39)51(69)57-33-27-21-15-9-3)42-40(38)64-47(53(71)59-35-29-23-17-11-5)48(66-42)54(72)60-36-30-24-18-12-6/h7-36H2,1-6H3,(H,55,67)(H,56,68)(H,57,69)(H,58,70)(H,59,71)(H,60,72) |
| InChIKey | YPCFQFWFTUICAU-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 251.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 72 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.34 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|