C10H15Br2N3O — CID 19508407
4,5-dibromo-N-hexyl-1H-pyrazole-3-carboxamide (PubChem CID 19508407) has the molecular formula C10H15Br2N3O and a molecular weight of 353.06 g/mol. Its IUPAC name is 4,5-dibromo-N-hexyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4,5-dibromo-N-hexyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508407 |
| Molecular Formula | C10H15Br2N3O |
| Molecular Weight | 353.06 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 4,5-dibromo-N-hexyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCCCCNC(=O)c1n[nH]c(Br)c1Br |
| InChI | InChI=1S/C10H15Br2N3O/c1-2-3-4-5-6-13-10(16)8-7(11)9(12)15-14-8/h2-6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | NWYGRBLRDUBYAM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.06 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|