C13H20BrN3O3 — CID 47061209
methyl 7-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]heptanoate (PubChem CID 47061209) has the molecular formula C13H20BrN3O3 and a molecular weight of 346.23 g/mol. Its IUPAC name is methyl 7-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]heptanoate.
| Compound Name | methyl 7-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]heptanoate |
|---|---|
| PubChem CID | 47061209 |
| Molecular Formula | C13H20BrN3O3 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | methyl 7-[(4-bromo-5-methyl-1H-pyrazole-3-carbonyl)amino]heptanoate |
| SMILES | COC(=O)CCCCCCNC(=O)c1n[nH]c(C)c1Br |
| InChI | InChI=1S/C13H20BrN3O3/c1-9-11(14)12(17-16-9)13(19)15-8-6-4-3-5-7-10(18)20-2/h3-8H2,1-2H3,(H,15,19)(H,16,17) |
| InChIKey | VSTIJXJMTHNECP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|