C16H18BrN3O3 — CID 60591032
methyl 5-[(4-bromo-3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoate (PubChem CID 60591032) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is methyl 5-[(4-bromo-3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoate.
| Compound Name | methyl 5-[(4-bromo-3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 60591032 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | methyl 5-[(4-bromo-3-phenyl-1H-pyrazole-5-carbonyl)amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1[nH]nc(-c2ccccc2)c1Br |
| InChI | InChI=1S/C16H18BrN3O3/c1-23-12(21)9-5-6-10-18-16(22)15-13(17)14(19-20-15)11-7-3-2-4-8-11/h2-4,7-8H,5-6,9-10H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | FTHBPPSJTYMLMA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|