About methyl 4-benzamidobutanoate
methyl 4-benzamidobutanoate (PubChem CID 13197711) has the molecular formula C12H15NO3
and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 4-benzamidobutanoate.
Molecular Properties
| Compound Name | methyl 4-benzamidobutanoate |
| PubChem CID | 13197711 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl 4-benzamidobutanoate |
| SMILES | COC(=O)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-16-11(14)8-5-9-13-12(15)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,13,15) |
| InChIKey | CYYGNAVEMUOULJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-benzamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-benzamidobutanoate?
The IUPAC name of methyl 4-benzamidobutanoate (CID 13197711) is methyl 4-benzamidobutanoate.
What is the SMILES notation for methyl 4-benzamidobutanoate?
The canonical SMILES for methyl 4-benzamidobutanoate is COC(=O)CCCNC(=O)c1ccccc1.
What is the InChIKey of methyl 4-benzamidobutanoate?
The InChIKey is CYYGNAVEMUOULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3/c1-16-11(14)8-5-9-13-12(15)10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,13,15).
What are the key properties of methyl 4-benzamidobutanoate?
methyl 4-benzamidobutanoate has a molecular weight of 221.26 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-benzamidobutanoate is sourced from PubChem (CID 13197711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).