C20H33NO3Si — CID 10808726
trimethylsilyl 10-benzamidodecanoate (PubChem CID 10808726) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is trimethylsilyl 10-benzamidodecanoate.
| Compound Name | trimethylsilyl 10-benzamidodecanoate |
|---|---|
| PubChem CID | 10808726 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | trimethylsilyl 10-benzamidodecanoate |
| SMILES | C[Si](C)(C)OC(=O)CCCCCCCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-25(2,3)24-19(22)16-12-7-5-4-6-8-13-17-21-20(23)18-14-10-9-11-15-18/h9-11,14-15H,4-8,12-13,16-17H2,1-3H3,(H,21,23) |
| InChIKey | AAGLQGCMNNMZGW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|