About trimethylsilyl 4-benzamidobutanoate
trimethylsilyl 4-benzamidobutanoate (PubChem CID 10802651) has the molecular formula C14H21NO3Si
and a molecular weight of 279.41 g/mol. Its IUPAC name is trimethylsilyl 4-benzamidobutanoate.
Molecular Properties
| Compound Name | trimethylsilyl 4-benzamidobutanoate |
| PubChem CID | 10802651 |
| Molecular Formula | C14H21NO3Si |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | trimethylsilyl 4-benzamidobutanoate |
| SMILES | C[Si](C)(C)OC(=O)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3Si/c1-19(2,3)18-13(16)10-7-11-15-14(17)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,15,17) |
| InChIKey | CFBQAPOGQATWHJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 4-benzamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 4-benzamidobutanoate?
The IUPAC name of trimethylsilyl 4-benzamidobutanoate (CID 10802651) is trimethylsilyl 4-benzamidobutanoate.
What is the SMILES notation for trimethylsilyl 4-benzamidobutanoate?
The canonical SMILES for trimethylsilyl 4-benzamidobutanoate is C[Si](C)(C)OC(=O)CCCNC(=O)c1ccccc1.
What is the InChIKey of trimethylsilyl 4-benzamidobutanoate?
The InChIKey is CFBQAPOGQATWHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3Si/c1-19(2,3)18-13(16)10-7-11-15-14(17)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,15,17).
What are the key properties of trimethylsilyl 4-benzamidobutanoate?
trimethylsilyl 4-benzamidobutanoate has a molecular weight of 279.41 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 4-benzamidobutanoate is sourced from PubChem (CID 10802651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).