C18H28FNO3Si — CID 10760551
trimethylsilyl 8-[(2-fluorobenzoyl)amino]octanoate (PubChem CID 10760551) has the molecular formula C18H28FNO3Si and a molecular weight of 353.51 g/mol. Its IUPAC name is trimethylsilyl 8-[(2-fluorobenzoyl)amino]octanoate.
| Compound Name | trimethylsilyl 8-[(2-fluorobenzoyl)amino]octanoate |
|---|---|
| PubChem CID | 10760551 |
| Molecular Formula | C18H28FNO3Si |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | trimethylsilyl 8-[(2-fluorobenzoyl)amino]octanoate |
| SMILES | C[Si](C)(C)OC(=O)CCCCCCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H28FNO3Si/c1-24(2,3)23-17(21)13-7-5-4-6-10-14-20-18(22)15-11-8-9-12-16(15)19/h8-9,11-12H,4-7,10,13-14H2,1-3H3,(H,20,22) |
| InChIKey | JAGISNDYZALXDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|