C13H18FNO — CID 60738338
2-fluoro-N-(4-methylpentyl)benzamide (PubChem CID 60738338) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-fluoro-N-(4-methylpentyl)benzamide.
| Compound Name | 2-fluoro-N-(4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 60738338 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-fluoro-N-(4-methylpentyl)benzamide |
| SMILES | CC(C)CCCNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H18FNO/c1-10(2)6-5-9-15-13(16)11-7-3-4-8-12(11)14/h3-4,7-8,10H,5-6,9H2,1-2H3,(H,15,16) |
| InChIKey | WLXGRPSEPUZUNM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|