C12H13F4NO — CID 113322083
2-fluoro-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 113322083) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-fluoro-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 2-fluoro-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 113322083 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-fluoro-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C12H13F4NO/c13-10-6-2-1-5-9(10)11(18)17-8-4-3-7-12(14,15)16/h1-2,5-6H,3-4,7-8H2,(H,17,18) |
| InChIKey | GHXQONKTMCWBAX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|