C12H12BrClF3NO — CID 103839346
2-bromo-4-chloro-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 103839346) has the molecular formula C12H12BrClF3NO and a molecular weight of 358.59 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 103839346 |
| Molecular Formula | C12H12BrClF3NO |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 2-bromo-4-chloro-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H12BrClF3NO/c13-10-7-8(14)3-4-9(10)11(19)18-6-2-1-5-12(15,16)17/h3-4,7H,1-2,5-6H2,(H,18,19) |
| InChIKey | ADTGBFOZCBERPA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|