C13H17BrClNO2 — CID 103862023
2-bromo-4-chloro-N-(5-hydroxy-4-methylpentyl)benzamide (PubChem CID 103862023) has the molecular formula C13H17BrClNO2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-(5-hydroxy-4-methylpentyl)benzamide.
| Compound Name | 2-bromo-4-chloro-N-(5-hydroxy-4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 103862023 |
| Molecular Formula | C13H17BrClNO2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-bromo-4-chloro-N-(5-hydroxy-4-methylpentyl)benzamide |
| SMILES | CC(CO)CCCNC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H17BrClNO2/c1-9(8-17)3-2-6-16-13(18)11-5-4-10(15)7-12(11)14/h4-5,7,9,17H,2-3,6,8H2,1H3,(H,16,18) |
| InChIKey | KYBRCIKVBJHIQM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|