C12H14Br2ClNO2 — CID 106245083
2-bromo-N-(3-bromo-4-methoxybutyl)-4-chlorobenzamide (PubChem CID 106245083) has the molecular formula C12H14Br2ClNO2 and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-bromo-N-(3-bromo-4-methoxybutyl)-4-chlorobenzamide.
| Compound Name | 2-bromo-N-(3-bromo-4-methoxybutyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 106245083 |
| Molecular Formula | C12H14Br2ClNO2 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 396.91 |
| IUPAC Name | 2-bromo-N-(3-bromo-4-methoxybutyl)-4-chlorobenzamide |
| SMILES | COCC(Br)CCNC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H14Br2ClNO2/c1-18-7-8(13)4-5-16-12(17)10-3-2-9(15)6-11(10)14/h2-3,6,8H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | ZOTVYHRLTWLUSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|