C12H16BrClN2O — CID 107990240
2-bromo-4-chloro-N-[2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 107990240) has the molecular formula C12H16BrClN2O and a molecular weight of 319.63 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-[2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 2-bromo-4-chloro-N-[2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 107990240 |
| Molecular Formula | C12H16BrClN2O |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-bromo-4-chloro-N-[2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)NCCNC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H16BrClN2O/c1-8(2)15-5-6-16-12(17)10-4-3-9(14)7-11(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | SNAGFYIAHSKGLF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|