C13H15BrClNO3 — CID 91659527
methyl 5-[(2-bromo-4-chlorobenzoyl)amino]pentanoate (PubChem CID 91659527) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is methyl 5-[(2-bromo-4-chlorobenzoyl)amino]pentanoate.
| Compound Name | methyl 5-[(2-bromo-4-chlorobenzoyl)amino]pentanoate |
|---|---|
| PubChem CID | 91659527 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | methyl 5-[(2-bromo-4-chlorobenzoyl)amino]pentanoate |
| SMILES | COC(=O)CCCCNC(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H15BrClNO3/c1-19-12(17)4-2-3-7-16-13(18)10-6-5-9(15)8-11(10)14/h5-6,8H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | CBICCRAWISFIJW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|