C14H17BrClNO3 — CID 103841612
methyl 6-[(3-bromo-4-chlorobenzoyl)amino]hexanoate (PubChem CID 103841612) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is methyl 6-[(3-bromo-4-chlorobenzoyl)amino]hexanoate.
| Compound Name | methyl 6-[(3-bromo-4-chlorobenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 103841612 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | methyl 6-[(3-bromo-4-chlorobenzoyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H17BrClNO3/c1-20-13(18)5-3-2-4-8-17-14(19)10-6-7-12(16)11(15)9-10/h6-7,9H,2-5,8H2,1H3,(H,17,19) |
| InChIKey | JDHUALIDZCKYFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|