C12H13BrClNO3 — CID 107997905
5-[(3-bromo-4-chlorobenzoyl)amino]pentanoic acid (PubChem CID 107997905) has the molecular formula C12H13BrClNO3 and a molecular weight of 334.60 g/mol. Its IUPAC name is 5-[(3-bromo-4-chlorobenzoyl)amino]pentanoic acid.
| Compound Name | 5-[(3-bromo-4-chlorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107997905 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 5-[(3-bromo-4-chlorobenzoyl)amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H13BrClNO3/c13-9-7-8(4-5-10(9)14)12(18)15-6-2-1-3-11(16)17/h4-5,7H,1-3,6H2,(H,15,18)(H,16,17) |
| InChIKey | PBRSVKDRGGZVFL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|