C13H15ClN2O5 — CID 103602649
6-[(4-chloro-3-nitrobenzoyl)amino]hexanoic acid (PubChem CID 103602649) has the molecular formula C13H15ClN2O5 and a molecular weight of 314.72 g/mol. Its IUPAC name is 6-[(4-chloro-3-nitrobenzoyl)amino]hexanoic acid.
| Compound Name | 6-[(4-chloro-3-nitrobenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 103602649 |
| Molecular Formula | C13H15ClN2O5 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 6-[(4-chloro-3-nitrobenzoyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15ClN2O5/c14-10-6-5-9(8-11(10)16(20)21)13(19)15-7-3-1-2-4-12(17)18/h5-6,8H,1-4,7H2,(H,15,19)(H,17,18) |
| InChIKey | DCVSZWFKUSMYLO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|