C13H14BrN3O7 — CID 5245379
6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid (PubChem CID 5245379) has the molecular formula C13H14BrN3O7 and a molecular weight of 404.17 g/mol. Its IUPAC name is 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid.
| Compound Name | 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 5245379 |
| Molecular Formula | C13H14BrN3O7 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14BrN3O7/c14-12-9(16(21)22)6-8(7-10(12)17(23)24)13(20)15-5-3-1-2-4-11(18)19/h6-7H,1-5H2,(H,15,20)(H,18,19) |
| InChIKey | LDRLGKRGWDTZAO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 152.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|