6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid

C13H14BrN3O7 — CID 5245379

IUPAC6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid
SMILESO=C(O)CCCCCNC(=O)c1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1
InChIInChI=1S/C13H14BrN3O7/c14-12-9(16(21)22)6-8(7-10(12)17(23)24)13(20)15-5-3-1-2-4-11(18)19/h6-7H,1-5H2,(H,15,20)(H,18,19)
InChIKeyLDRLGKRGWDTZAO-UHFFFAOYSA-N
MW404.17 g/mol
LogP2.64
Rot. Bonds9

About 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid

6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid (PubChem CID 5245379) has the molecular formula C13H14BrN3O7 and a molecular weight of 404.17 g/mol. Its IUPAC name is 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid.

Molecular Properties

Compound Name6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid
PubChem CID5245379
Molecular FormulaC13H14BrN3O7
Molecular Weight404.17 g/mol
Exact Mass403.00
IUPAC Name6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid
SMILESO=C(O)CCCCCNC(=O)c1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1
InChIInChI=1S/C13H14BrN3O7/c14-12-9(16(21)22)6-8(7-10(12)17(23)24)13(20)15-5-3-1-2-4-11(18)19/h6-7H,1-5H2,(H,15,20)(H,18,19)
InChIKeyLDRLGKRGWDTZAO-UHFFFAOYSA-N
XLogP2.64
TPSA152.68 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500404.17
LogP ≤ 52.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid?
The IUPAC name of 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid (CID 5245379) is 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid.
What is the SMILES notation for 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid?
The canonical SMILES for 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid is O=C(O)CCCCCNC(=O)c1cc([N+](=O)[O-])c(Br)c([N+](=O)[O-])c1.
What is the InChIKey of 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid?
The InChIKey is LDRLGKRGWDTZAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3O7/c14-12-9(16(21)22)6-8(7-10(12)17(23)24)13(20)15-5-3-1-2-4-11(18)19/h6-7H,1-5H2,(H,15,20)(H,18,19).
What are the key properties of 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid?
6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid has a molecular weight of 404.17 g/mol, XLogP of 2.64, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-bromo-3,5-dinitrobenzoyl)amino]hexanoic acid is sourced from PubChem (CID 5245379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).