C22H24N6O10 — CID 4596200
N-[8-[(3,5-dinitrobenzoyl)amino]octyl]-3,5-dinitrobenzamide (PubChem CID 4596200) has the molecular formula C22H24N6O10 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-[8-[(3,5-dinitrobenzoyl)amino]octyl]-3,5-dinitrobenzamide.
| Compound Name | N-[8-[(3,5-dinitrobenzoyl)amino]octyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4596200 |
| Molecular Formula | C22H24N6O10 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | N-[8-[(3,5-dinitrobenzoyl)amino]octyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCCCCCCCCNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N6O10/c29-21(15-9-17(25(31)32)13-18(10-15)26(33)34)23-7-5-3-1-2-4-6-8-24-22(30)16-11-19(27(35)36)14-20(12-16)28(37)38/h9-14H,1-8H2,(H,23,29)(H,24,30) |
| InChIKey | DFPXBUYMDUNTDL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 230.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|