C21H24N4O6 — CID 3626830
3-nitro-N-[7-[(3-nitrobenzoyl)amino]heptyl]benzamide (PubChem CID 3626830) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-nitro-N-[7-[(3-nitrobenzoyl)amino]heptyl]benzamide.
| Compound Name | 3-nitro-N-[7-[(3-nitrobenzoyl)amino]heptyl]benzamide |
|---|---|
| PubChem CID | 3626830 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-nitro-N-[7-[(3-nitrobenzoyl)amino]heptyl]benzamide |
| SMILES | O=C(NCCCCCCCNC(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H24N4O6/c26-20(16-8-6-10-18(14-16)24(28)29)22-12-4-2-1-3-5-13-23-21(27)17-9-7-11-19(15-17)25(30)31/h6-11,14-15H,1-5,12-13H2,(H,22,26)(H,23,27) |
| InChIKey | ZJVZNLJQBLKBMT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|