C18H20N4O4 — CID 82097424
N-[3-[[4-(aminomethyl)benzoyl]amino]propyl]-3-nitrobenzamide (PubChem CID 82097424) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[3-[[4-(aminomethyl)benzoyl]amino]propyl]-3-nitrobenzamide.
| Compound Name | N-[3-[[4-(aminomethyl)benzoyl]amino]propyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 82097424 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[3-[[4-(aminomethyl)benzoyl]amino]propyl]-3-nitrobenzamide |
| SMILES | NCc1ccc(C(=O)NCCCNC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H20N4O4/c19-12-13-5-7-14(8-6-13)17(23)20-9-2-10-21-18(24)15-3-1-4-16(11-15)22(25)26/h1,3-8,11H,2,9-10,12,19H2,(H,20,23)(H,21,24) |
| InChIKey | ZYXSTQDPADHERM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|