C26H39N4O22P5 — CID 123712463
bis[hydroxy-[hydroxy-[6-[(3-nitrobenzoyl)amino]hexoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate (PubChem CID 123712463) has the molecular formula C26H39N4O22P5 and a molecular weight of 914.47 g/mol. Its IUPAC name is bis[hydroxy-[hydroxy-[6-[(3-nitrobenzoyl)amino]hexoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate.
| Compound Name | bis[hydroxy-[hydroxy-[6-[(3-nitrobenzoyl)amino]hexoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 123712463 |
| Molecular Formula | C26H39N4O22P5 |
| Molecular Weight | 914.47 g/mol |
| Exact Mass | 914.07 |
| IUPAC Name | bis[hydroxy-[hydroxy-[6-[(3-nitrobenzoyl)amino]hexoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate |
| SMILES | O=C(NCCCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCCCCCCNC(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H39N4O22P5/c31-25(21-11-9-13-23(19-21)29(33)34)27-15-5-1-3-7-17-47-53(37,38)49-55(41,42)51-57(45,46)52-56(43,44)50-54(39,40)48-18-8-4-2-6-16-28-26(32)22-12-10-14-24(20-22)30(35)36/h9-14,19-20H,1-8,15-18H2,(H,27,31)(H,28,32)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | JYNCVJISHXOWDR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 386.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|