C15H28N2O22P6 — CID 157454557
[hydroxy-[hydroxy-[hydroxy-[hydroxy-[6-[3-(3-nitrophenyl)propanoylamino]hexoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 157454557) has the molecular formula C15H28N2O22P6 and a molecular weight of 774.22 g/mol. Its IUPAC name is [hydroxy-[hydroxy-[hydroxy-[hydroxy-[6-[3-(3-nitrophenyl)propanoylamino]hexoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[hydroxy-[hydroxy-[hydroxy-[6-[3-(3-nitrophenyl)propanoylamino]hexoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 157454557 |
| Molecular Formula | C15H28N2O22P6 |
| Molecular Weight | 774.22 g/mol |
| Exact Mass | 773.96 |
| IUPAC Name | [hydroxy-[hydroxy-[hydroxy-[hydroxy-[6-[3-(3-nitrophenyl)propanoylamino]hexoxy]phosphoryl]oxyphosphoryl]oxyphosphoryl]oxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C(CCc1cccc([N+](=O)[O-])c1)NCCCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H28N2O22P6/c18-15(9-8-13-6-5-7-14(12-13)17(19)20)16-10-3-1-2-4-11-34-41(24,25)36-43(28,29)38-45(32,33)39-44(30,31)37-42(26,27)35-40(21,22)23/h5-7,12H,1-4,8-11H2,(H,16,18)(H,24,25)(H,26,27)(H,28,29)(H,30,31)(H,32,33)(H2,21,22,23) |
| InChIKey | BTEUDLABTRKVOH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 371.65 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|