C13H15N5O3 — CID 71972626
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-nitrophenyl)propanamide (PubChem CID 71972626) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-nitrophenyl)propanamide.
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 71972626 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(3-nitrophenyl)propanamide |
| SMILES | Cn1cnnc1CNC(=O)CCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15N5O3/c1-17-9-15-16-12(17)8-14-13(19)6-5-10-3-2-4-11(7-10)18(20)21/h2-4,7,9H,5-6,8H2,1H3,(H,14,19) |
| InChIKey | XLZLKBUSPWCYEI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|