C16H21F3N4O3 — CID 120812383
3-(3-nitrophenyl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (PubChem CID 120812383) has the molecular formula C16H21F3N4O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
| Compound Name | 3-(3-nitrophenyl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 120812383 |
| Molecular Formula | C16H21F3N4O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-(3-nitrophenyl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| SMILES | O=C(CCc1cccc([N+](=O)[O-])c1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N4O3/c17-16(18,19)14(22-8-6-20-7-9-22)11-21-15(24)5-4-12-2-1-3-13(10-12)23(25)26/h1-3,10,14,20H,4-9,11H2,(H,21,24) |
| InChIKey | WIQAQXIVWSVZFE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|