C12H17F3N6O3 — CID 120813291
2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120813291) has the molecular formula C12H17F3N6O3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120813291 |
| Molecular Formula | C12H17F3N6O3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N6O3/c13-12(14,15)10(19-3-1-16-2-4-19)6-17-11(22)8-20-7-9(5-18-20)21(23)24/h5,7,10,16H,1-4,6,8H2,(H,17,22) |
| InChIKey | FYNQXPTVBABHIA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|