C11H16F3N7O3 — CID 120813317
2-(3-nitro-1,2,4-triazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120813317) has the molecular formula C11H16F3N7O3 and a molecular weight of 351.29 g/mol. Its IUPAC name is 2-(3-nitro-1,2,4-triazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120813317 |
| Molecular Formula | C11H16F3N7O3 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N7O3/c12-11(13,14)8(19-3-1-15-2-4-19)5-16-9(22)6-20-7-17-10(18-20)21(23)24/h7-8,15H,1-6H2,(H,16,22) |
| InChIKey | XSYLNYKVGFXOGJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|