C14H22ClF3N6O3 — CID 120813654
2-methyl-2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide;hydrochloride (PubChem CID 120813654) has the molecular formula C14H22ClF3N6O3 and a molecular weight of 414.82 g/mol. Its IUPAC name is 2-methyl-2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide;hydrochloride.
| Compound Name | 2-methyl-2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120813654 |
| Molecular Formula | C14H22ClF3N6O3 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-methyl-2-(4-nitropyrazol-1-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide;hydrochloride |
| SMILES | CC(C)(C(=O)NCC(N1CCNCC1)C(F)(F)F)n1cc([N+](=O)[O-])cn1.Cl |
| InChI | InChI=1S/C14H21F3N6O3.ClH/c1-13(2,22-9-10(7-20-22)23(25)26)12(24)19-8-11(14(15,16)17)21-5-3-18-4-6-21;/h7,9,11,18H,3-6,8H2,1-2H3,(H,19,24);1H |
| InChIKey | MIQFHEWRFKAFQT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|